C26H34N7O5P — CID 153426474
cyclohexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(3-isocyanophenoxy)phosphoryl]amino]-2-methylpropanoate (PubChem CID 153426474) has the molecular formula C26H34N7O5P and a molecular weight of 555.58 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(3-isocyanophenoxy)phosphoryl]amino]-2-methylpropanoate.
| Compound Name | cyclohexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(3-isocyanophenoxy)phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 153426474 |
| Molecular Formula | C26H34N7O5P |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | cyclohexyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(3-isocyanophenoxy)phosphoryl]amino]-2-methylpropanoate |
| SMILES | [C-]#[N+]c1cccc(OP(=O)(CO[C@H](C)Cn2cnc3c(N)ncnc32)NC(C)(C)C(=O)OC2CCCCC2)c1 |
| InChI | InChI=1S/C26H34N7O5P/c1-18(14-33-16-31-22-23(27)29-15-30-24(22)33)36-17-39(35,38-21-12-8-9-19(13-21)28-4)32-26(2,3)25(34)37-20-10-6-5-7-11-20/h8-9,12-13,15-16,18,20H,5-7,10-11,14,17H2,1-3H3,(H,32,35)(H2,27,29,30)/t18-,39?/m1/s1 |
| InChIKey | AICJROYTVAXRON-CJCVFLICSA-N |
| XLogP | 4.84 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|