C18H28N6O4P+ — CID 166551715
1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-cyclopentyloxy-2-methyl-1-oxopropan-2-yl)amino]-oxophosphanium (PubChem CID 166551715) has the molecular formula C18H28N6O4P+ and a molecular weight of 423.43 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-cyclopentyloxy-2-methyl-1-oxopropan-2-yl)amino]-oxophosphanium.
| Compound Name | 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-cyclopentyloxy-2-methyl-1-oxopropan-2-yl)amino]-oxophosphanium |
|---|---|
| PubChem CID | 166551715 |
| Molecular Formula | C18H28N6O4P+ |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(1-cyclopentyloxy-2-methyl-1-oxopropan-2-yl)amino]-oxophosphanium |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OC[P+](=O)NC(C)(C)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C18H28N6O4P/c1-12(8-24-10-22-14-15(19)20-9-21-16(14)24)27-11-29(26)23-18(2,3)17(25)28-13-6-4-5-7-13/h9-10,12-13H,4-8,11H2,1-3H3,(H,23,26)(H2,19,20,21)/q+1 |
| InChIKey | BNVWQVKXEFVDEY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|