C23H40N6O7P+ — CID 166551598
1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(2-methyl-1-oxo-1-pentoxypropan-2-yl)amino]-oxophosphanium;propan-2-yl 2-hydroxyacetate (PubChem CID 166551598) has the molecular formula C23H40N6O7P+ and a molecular weight of 543.58 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(2-methyl-1-oxo-1-pentoxypropan-2-yl)amino]-oxophosphanium;propan-2-yl 2-hydroxyacetate.
| Compound Name | 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(2-methyl-1-oxo-1-pentoxypropan-2-yl)amino]-oxophosphanium;propan-2-yl 2-hydroxyacetate |
|---|---|
| PubChem CID | 166551598 |
| Molecular Formula | C23H40N6O7P+ |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-[(2-methyl-1-oxo-1-pentoxypropan-2-yl)amino]-oxophosphanium;propan-2-yl 2-hydroxyacetate |
| SMILES | CC(C)OC(=O)CO.CCCCCOC(=O)C(C)(C)N[P+](=O)COC(C)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C18H30N6O4P.C5H10O3/c1-5-6-7-8-27-17(25)18(3,4)23-29(26)12-28-13(2)9-24-11-22-14-15(19)20-10-21-16(14)24;1-4(2)8-5(7)3-6/h10-11,13H,5-9,12H2,1-4H3,(H,23,26)(H2,19,20,21);4,6H,3H2,1-2H3/q+1; |
| InChIKey | ZEBVPOFSINDPKM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 180.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|