C31H34F3IrN2O2S- — CID 153428529
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-propan-2-ylthieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-2-hydroxy-6-methylhept-2-en-4-one (PubChem CID 153428529) has the molecular formula C31H34F3IrN2O2S- and a molecular weight of 747.90 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-propan-2-ylthieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-2-hydroxy-6-methylhept-2-en-4-one.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-propan-2-ylthieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-2-hydroxy-6-methylhept-2-en-4-one |
|---|---|
| PubChem CID | 153428529 |
| Molecular Formula | C31H34F3IrN2O2S- |
| Molecular Weight | 747.90 g/mol |
| Exact Mass | 748.19 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-propan-2-ylthieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-2-hydroxy-6-methylhept-2-en-4-one |
| SMILES | CC(C)CC(=O)/C=C(\O)C(F)(F)F.CC(C)c1csc2c(-c3[c-]c4ccccc4c(C(C)(C)C)c3)ncnc12.[Ir] |
| InChI | InChI=1S/C23H23N2S.C8H11F3O2.Ir/c1-14(2)18-12-26-22-20(24-13-25-21(18)22)16-10-15-8-6-7-9-17(15)19(11-16)23(3,4)5;1-5(2)3-6(12)4-7(13)8(9,10)11;/h6-9,11-14H,1-5H3;4-5,13H,3H2,1-2H3;/q-1;;/b;7-4-; |
| InChIKey | TXSQBKKBIHVXDK-XTXOHDESSA-N |
| XLogP | 9.34 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.90 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|