C38H48F3IrN2O2S- — CID 153484595
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 153484595) has the molecular formula C38H48F3IrN2O2S- and a molecular weight of 846.09 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 153484595 |
| Molecular Formula | C38H48F3IrN2O2S- |
| Molecular Weight | 846.09 g/mol |
| Exact Mass | 846.30 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)thieno[3,2-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(C)c1cc(-c2ncnc3c(CC(C)(C)C(F)(F)F)csc23)[c-]c2ccccc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C25H24F3N2S.C13H24O2.Ir/c1-23(2,3)19-11-16(10-15-8-6-7-9-18(15)19)20-22-21(30-14-29-20)17(13-31-22)12-24(4,5)25(26,27)28;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-9,11,13-14H,12H2,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | PKBGPRQLJWGGKB-DZTQYQPZSA-N |
| XLogP | 11.61 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.09 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|