C32H33F6IrN2O2S- — CID 153484615
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-methyl-7-(4,4,4-trifluorobutyl)thieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one (PubChem CID 153484615) has the molecular formula C32H33F6IrN2O2S- and a molecular weight of 815.90 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-methyl-7-(4,4,4-trifluorobutyl)thieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-methyl-7-(4,4,4-trifluorobutyl)thieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one |
|---|---|
| PubChem CID | 153484615 |
| Molecular Formula | C32H33F6IrN2O2S- |
| Molecular Weight | 815.90 g/mol |
| Exact Mass | 816.18 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-methyl-7-(4,4,4-trifluorobutyl)thieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5-methylhex-3-en-2-one |
| SMILES | CC(C)/C(O)=C/C(=O)C(F)(F)F.Cc1sc2c(-c3[c-]c4ccccc4c(C(C)(C)C)c3)ncnc2c1CCCC(F)(F)F.[Ir] |
| InChI | InChI=1S/C25H24F3N2S.C7H9F3O2.Ir/c1-15-18(10-7-11-25(26,27)28)22-23(31-15)21(29-14-30-22)17-12-16-8-5-6-9-19(16)20(13-17)24(2,3)4;1-4(2)5(11)3-6(12)7(8,9)10;/h5-6,8-9,13-14H,7,10-11H2,1-4H3;3-4,11H,1-2H3;/q-1;;/b;5-3-; |
| InChIKey | WBSHVEMAMTYATG-FMFSYIAASA-N |
| XLogP | 10.02 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.90 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|