C36H44F3IrN2O2S- — CID 153428525
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-6-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;iridium (PubChem CID 153428525) has the molecular formula C36H44F3IrN2O2S- and a molecular weight of 818.04 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-6-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-6-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;iridium |
|---|---|
| PubChem CID | 153428525 |
| Molecular Formula | C36H44F3IrN2O2S- |
| Molecular Weight | 818.04 g/mol |
| Exact Mass | 818.27 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-6-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2ncnc3c2sc2c(CC(C)(C)C(F)(F)F)cccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C23H20F3N2S.C13H24O2.Ir/c1-13-8-14(2)10-16(9-13)18-21-19(28-12-27-18)17-7-5-6-15(20(17)29-21)11-22(3,4)23(24,25)26;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-9,12H,11H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | IFYAXYBTQNTLTD-DZTQYQPZSA-N |
| XLogP | 10.93 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.04 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|