C27H29IrN2O2S- — CID 153428557
4-(3,5-dimethylbenzene-6-id-1-yl)-7-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 153428557) has the molecular formula C27H29IrN2O2S- and a molecular weight of 637.83 g/mol. Its IUPAC name is 4-(3,5-dimethylbenzene-6-id-1-yl)-7-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-7-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 153428557 |
| Molecular Formula | C27H29IrN2O2S- |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-7-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1[c-]c(-c2ncnc3c2sc2cc(CC(C)C)ccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C22H21N2S.C5H8O2.Ir/c1-13(2)7-16-5-6-18-19(11-16)25-22-20(23-12-24-21(18)22)17-9-14(3)8-15(4)10-17;1-4(6)3-5(2)7;/h5-6,8-9,11-13H,7H2,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | BJZPWYMDUFTEJU-LWFKIUJUSA-N |
| XLogP | 7.16 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|