C28H32IrO2-2 — CID 168739600
2-(3,5-dimethylbenzene-6-id-1-yl)-1-methanidyl-5-(2-methylpropyl)naphthalene;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 168739600) has the molecular formula C28H32IrO2-2 and a molecular weight of 592.78 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-1-methanidyl-5-(2-methylpropyl)naphthalene;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-1-methanidyl-5-(2-methylpropyl)naphthalene;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 168739600 |
| Molecular Formula | C28H32IrO2-2 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-1-methanidyl-5-(2-methylpropyl)naphthalene;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[CH2-]c1c(-c2[c-]c(C)cc(C)c2)ccc2c(CC(C)C)cccc12.[Ir] |
| InChI | InChI=1S/C23H24.C5H8O2.Ir/c1-15(2)11-19-7-6-8-22-18(5)21(9-10-23(19)22)20-13-16(3)12-17(4)14-20;1-4(6)3-5(2)7;/h6-10,12-13,15H,5,11H2,1-4H3;3,6H,1-2H3;/q-2;;/b;4-3-; |
| InChIKey | BANMVNPKPZUZGO-LWFKIUJUSA-N |
| XLogP | 7.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|