C46H39N3Pt — CID 153428747
5-(4-tert-butyl-2-pyridinyl)-7-[9-[3-(4-tert-butyl-2-pyridinyl)benzene-2-id-1-yl]fluoren-9-yl]-6H-quinolin-6-ide;platinum(2+) (PubChem CID 153428747) has the molecular formula C46H39N3Pt and a molecular weight of 828.92 g/mol. Its IUPAC name is 5-(4-tert-butyl-2-pyridinyl)-7-[9-[3-(4-tert-butyl-2-pyridinyl)benzene-2-id-1-yl]fluoren-9-yl]-6H-quinolin-6-ide;platinum(2+).
| Compound Name | 5-(4-tert-butyl-2-pyridinyl)-7-[9-[3-(4-tert-butyl-2-pyridinyl)benzene-2-id-1-yl]fluoren-9-yl]-6H-quinolin-6-ide;platinum(2+) |
|---|---|
| PubChem CID | 153428747 |
| Molecular Formula | C46H39N3Pt |
| Molecular Weight | 828.92 g/mol |
| Exact Mass | 828.28 |
| IUPAC Name | 5-(4-tert-butyl-2-pyridinyl)-7-[9-[3-(4-tert-butyl-2-pyridinyl)benzene-2-id-1-yl]fluoren-9-yl]-6H-quinolin-6-ide;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]c(C3(c4[c-]c(-c5cc(C(C)(C)C)ccn5)c5cccnc5c4)c4ccccc4-c4ccccc43)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C46H39N3.Pt/c1-44(2,3)31-20-23-48-41(27-31)30-13-11-14-33(25-30)46(39-18-9-7-15-35(39)36-16-8-10-19-40(36)46)34-26-38(37-17-12-22-47-42(37)29-34)43-28-32(21-24-49-43)45(4,5)6;/h7-24,27-29H,1-6H3;/q-2;+2 |
| InChIKey | JWJCMXNZMDDHQH-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.92 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|