C51H42N2Pt — CID 153428761
3-[3-tert-butyl-5-[9-[4-(4-tert-butyl-2-pyridinyl)-3H-naphthalen-3-id-2-yl]fluoren-9-yl]benzene-6-id-1-yl]isoquinoline;platinum(2+) (PubChem CID 153428761) has the molecular formula C51H42N2Pt and a molecular weight of 877.99 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-[9-[4-(4-tert-butyl-2-pyridinyl)-3H-naphthalen-3-id-2-yl]fluoren-9-yl]benzene-6-id-1-yl]isoquinoline;platinum(2+).
| Compound Name | 3-[3-tert-butyl-5-[9-[4-(4-tert-butyl-2-pyridinyl)-3H-naphthalen-3-id-2-yl]fluoren-9-yl]benzene-6-id-1-yl]isoquinoline;platinum(2+) |
|---|---|
| PubChem CID | 153428761 |
| Molecular Formula | C51H42N2Pt |
| Molecular Weight | 877.99 g/mol |
| Exact Mass | 877.30 |
| IUPAC Name | 3-[3-tert-butyl-5-[9-[4-(4-tert-butyl-2-pyridinyl)-3H-naphthalen-3-id-2-yl]fluoren-9-yl]benzene-6-id-1-yl]isoquinoline;platinum(2+) |
| SMILES | CC(C)(C)c1cc(-c2cc3ccccc3cn2)[c-]c(C2(c3[c-]c(-c4cc(C(C)(C)C)ccn4)c4ccccc4c3)c3ccccc3-c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C51H42N2.Pt/c1-49(2,3)37-23-24-52-48(31-37)44-30-40(25-34-16-9-10-18-41(34)44)51(45-21-13-11-19-42(45)43-20-12-14-22-46(43)51)39-27-36(26-38(29-39)50(4,5)6)47-28-33-15-7-8-17-35(33)32-53-47;/h7-26,28-29,31-32H,1-6H3;/q-2;+2 |
| InChIKey | IIDZDFCSGAJDDN-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.99 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|