C50H34N4Pt — CID 153429010
CID 153429010 (PubChem CID 153429010) has the molecular formula C50H34N4Pt and a molecular weight of 885.93 g/mol.
| Compound Name | CID 153429010 |
|---|---|
| PubChem CID | 153429010 |
| Molecular Formula | C50H34N4Pt |
| Molecular Weight | 885.93 g/mol |
| Exact Mass | 885.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2nccc3ccccc23)[c-]c(C2(c3[c-]c4c(cc3)c3cccnc3n3c5ccccc5nc43)c3ccccc3-c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C50H34N4.Pt/c1-49(2,3)34-27-32(46-36-14-5-4-13-31(36)24-26-51-46)28-35(29-34)50(42-18-8-6-15-38(42)39-16-7-9-19-43(39)50)33-22-23-37-40-17-12-25-52-47(40)54-45-21-11-10-20-44(45)53-48(54)41(37)30-33;/h4-27,29H,1-3H3;/q-2;+2 |
| InChIKey | VGXRWGMUXWRRSN-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.93 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|