C51H35N3Pt — CID 153428904
CID 153428904 (PubChem CID 153428904) has the molecular formula C51H35N3Pt and a molecular weight of 884.94 g/mol.
| Compound Name | CID 153428904 |
|---|---|
| PubChem CID | 153428904 |
| Molecular Formula | C51H35N3Pt |
| Molecular Weight | 884.94 g/mol |
| Exact Mass | 884.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2nccc3ccccc23)[c-]c(C2(c3[c-]c4c(cc3)c3ccccc3n3c5ccccc5nc43)c3ccccc3-c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C51H35N3.Pt/c1-50(2,3)35-28-33(48-37-15-5-4-14-32(37)26-27-52-48)29-36(30-35)51(43-19-9-6-16-39(43)40-17-7-10-20-44(40)51)34-24-25-38-41-18-8-12-22-46(41)54-47-23-13-11-21-45(47)53-49(54)42(38)31-34;/h4-28,30H,1-3H3;/q-2;+2 |
| InChIKey | IIWXUBONZOFEOF-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.94 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|