C7H11NaO7 — CID 153429784
sodium 2-hydroxy-2-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]acetate (PubChem CID 153429784) has the molecular formula C7H11NaO7 and a molecular weight of 230.15 g/mol. Its IUPAC name is sodium 2-hydroxy-2-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]acetate.
| Compound Name | sodium 2-hydroxy-2-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 153429784 |
| Molecular Formula | C7H11NaO7 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | sodium 2-hydroxy-2-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]acetate |
| SMILES | O=C([O-])C(O)C1OC[C@@H](O)[C@H](O)[C@H]1O.[Na+] |
| InChI | InChI=1S/C7H12O7.Na/c8-2-1-14-6(4(10)3(2)9)5(11)7(12)13;/h2-6,8-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3+,4-,5?,6?;/m1./s1 |
| InChIKey | RTEWRCHSNHCPMS-AHDFEMONSA-M |
| XLogP | -7.42 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | -7.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |