C9H14O8 — CID 174050494
4-hydroxy-3-oxo-4-[(2S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]butanoic acid (PubChem CID 174050494) has the molecular formula C9H14O8 and a molecular weight of 250.20 g/mol. Its IUPAC name is 4-hydroxy-3-oxo-4-[(2S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]butanoic acid.
| Compound Name | 4-hydroxy-3-oxo-4-[(2S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 174050494 |
| Molecular Formula | C9H14O8 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-hydroxy-3-oxo-4-[(2S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]butanoic acid |
| SMILES | O=C(O)CC(=O)C(O)[C@H]1OC[C@H](O)[C@@H](O)C1O |
| InChI | InChI=1S/C9H14O8/c10-3(1-5(12)13)7(15)9-8(16)6(14)4(11)2-17-9/h4,6-9,11,14-16H,1-2H2,(H,12,13)/t4-,6+,7?,8?,9+/m0/s1 |
| InChIKey | FAJFXDFJCGEZEE-KZXNCGHWSA-N |
| XLogP | -3.13 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|