C13H13ClN6O3 — CID 153430062
2-amino-9-[(1S,2Z,3S,4S)-2-(chloromethylidene)-4-hydroxy-3-(hydroxymethyl)-3-isocyanocyclopentyl]-1H-purin-6-one (PubChem CID 153430062) has the molecular formula C13H13ClN6O3 and a molecular weight of 336.74 g/mol. Its IUPAC name is 2-amino-9-[(1S,2Z,3S,4S)-2-(chloromethylidene)-4-hydroxy-3-(hydroxymethyl)-3-isocyanocyclopentyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,2Z,3S,4S)-2-(chloromethylidene)-4-hydroxy-3-(hydroxymethyl)-3-isocyanocyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 153430062 |
| Molecular Formula | C13H13ClN6O3 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-amino-9-[(1S,2Z,3S,4S)-2-(chloromethylidene)-4-hydroxy-3-(hydroxymethyl)-3-isocyanocyclopentyl]-1H-purin-6-one |
| SMILES | [C-]#[N+][C@]1(CO)/C(=C\Cl)[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@@H]1O |
| InChI | InChI=1S/C13H13ClN6O3/c1-16-13(4-21)6(3-14)7(2-8(13)22)20-5-17-9-10(20)18-12(15)19-11(9)23/h3,5,7-8,21-22H,2,4H2,(H3,15,18,19,23)/b6-3-/t7-,8-,13+/m0/s1 |
| InChIKey | CMIMSRQTGNOVMU-WLYGNKGGSA-N |
| XLogP | -0.22 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|