C24H20N4 — CID 153430545
(2S)-5-isocyano-2,3-dimethyl-1-(2-methyl-5-phenylphenyl)-2H-benzimidazole-4-carbonitrile (PubChem CID 153430545) has the molecular formula C24H20N4 and a molecular weight of 364.45 g/mol. Its IUPAC name is (2S)-5-isocyano-2,3-dimethyl-1-(2-methyl-5-phenylphenyl)-2H-benzimidazole-4-carbonitrile.
| Compound Name | (2S)-5-isocyano-2,3-dimethyl-1-(2-methyl-5-phenylphenyl)-2H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 153430545 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2S)-5-isocyano-2,3-dimethyl-1-(2-methyl-5-phenylphenyl)-2H-benzimidazole-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1C#N)N(C)[C@H](C)N2c1cc(-c2ccccc2)ccc1C |
| InChI | InChI=1S/C24H20N4/c1-16-10-11-19(18-8-6-5-7-9-18)14-23(16)28-17(2)27(4)24-20(15-25)21(26-3)12-13-22(24)28/h5-14,17H,1-2,4H3/t17-/m0/s1 |
| InChIKey | AHLZIKHFMGSPAK-KRWDZBQOSA-N |
| XLogP | 6.02 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|