C21H22N4 — CID 153430518
(2S)-5-isocyano-2,3-dimethyl-1-(2,3,5,6-tetramethylphenyl)-2H-benzimidazole-4-carbonitrile (PubChem CID 153430518) has the molecular formula C21H22N4 and a molecular weight of 330.44 g/mol. Its IUPAC name is (2S)-5-isocyano-2,3-dimethyl-1-(2,3,5,6-tetramethylphenyl)-2H-benzimidazole-4-carbonitrile.
| Compound Name | (2S)-5-isocyano-2,3-dimethyl-1-(2,3,5,6-tetramethylphenyl)-2H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 153430518 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2S)-5-isocyano-2,3-dimethyl-1-(2,3,5,6-tetramethylphenyl)-2H-benzimidazole-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1C#N)N(C)[C@H](C)N2c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C21H22N4/c1-12-10-13(2)15(4)20(14(12)3)25-16(5)24(7)21-17(11-22)18(23-6)8-9-19(21)25/h8-10,16H,1-5,7H3/t16-/m0/s1 |
| InChIKey | LMFCFCVTXMZTDM-INIZCTEOSA-N |
| XLogP | 5.28 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|