C20H20N4 — CID 153430425
(2S)-5,6-diisocyano-1,2-dimethyl-3-(2,4,6-trimethylphenyl)-2H-benzimidazole (PubChem CID 153430425) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is (2S)-5,6-diisocyano-1,2-dimethyl-3-(2,4,6-trimethylphenyl)-2H-benzimidazole.
| Compound Name | (2S)-5,6-diisocyano-1,2-dimethyl-3-(2,4,6-trimethylphenyl)-2H-benzimidazole |
|---|---|
| PubChem CID | 153430425 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2S)-5,6-diisocyano-1,2-dimethyl-3-(2,4,6-trimethylphenyl)-2H-benzimidazole |
| SMILES | [C-]#[N+]c1cc2c(cc1[N+]#[C-])N(c1c(C)cc(C)cc1C)[C@@H](C)N2C |
| InChI | InChI=1S/C20H20N4/c1-12-8-13(2)20(14(3)9-12)24-15(4)23(7)18-10-16(21-5)17(22-6)11-19(18)24/h8-11,15H,1-4,7H3/t15-/m0/s1 |
| InChIKey | GMOHDXKRZRAKQI-HNNXBMFYSA-N |
| XLogP | 5.65 |
| TPSA | 15.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|