C17H13N4+ — CID 153430561
5,6-diisocyano-1-methyl-3-(3-methylphenyl)benzimidazol-1-ium (PubChem CID 153430561) has the molecular formula C17H13N4+ and a molecular weight of 273.32 g/mol. Its IUPAC name is 5,6-diisocyano-1-methyl-3-(3-methylphenyl)benzimidazol-1-ium.
| Compound Name | 5,6-diisocyano-1-methyl-3-(3-methylphenyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 153430561 |
| Molecular Formula | C17H13N4+ |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 5,6-diisocyano-1-methyl-3-(3-methylphenyl)benzimidazol-1-ium |
| SMILES | [C-]#[N+]c1cc2c(cc1[N+]#[C-])[n+](C)cn2-c1cccc(C)c1 |
| InChI | InChI=1S/C17H13N4/c1-12-6-5-7-13(8-12)21-11-20(4)16-9-14(18-2)15(19-3)10-17(16)21/h5-11H,1,4H3/q+1 |
| InChIKey | MXLPXEABSOQJDA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|