C9H12N2 — CID 153432442
4-[(2S,3R)-2,3-dimethylaziridin-1-yl]pyridine (PubChem CID 153432442) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 4-[(2S,3R)-2,3-dimethylaziridin-1-yl]pyridine.
| Compound Name | 4-[(2S,3R)-2,3-dimethylaziridin-1-yl]pyridine |
|---|---|
| PubChem CID | 153432442 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4-[(2S,3R)-2,3-dimethylaziridin-1-yl]pyridine |
| SMILES | C[C@@H]1[C@H](C)N1c1ccncc1 |
| InChI | InChI=1S/C9H12N2/c1-7-8(2)11(7)9-3-5-10-6-4-9/h3-8H,1-2H3/t7-,8+,11? |
| InChIKey | NNFHMZQSLICNMB-OQJHAAMPSA-N |
| XLogP | 1.68 |
| TPSA | 15.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|