C31H32IrN3O2Se- — CID 153432920
10-tert-butyl-1-pyridin-2-yl-2H-phenoselenazin-2-ide;iridium;3,4,5,6-tetramethylpyridine-2-carboxylic acid (PubChem CID 153432920) has the molecular formula C31H32IrN3O2Se- and a molecular weight of 749.79 g/mol. Its IUPAC name is 10-tert-butyl-1-pyridin-2-yl-2H-phenoselenazin-2-ide;iridium;3,4,5,6-tetramethylpyridine-2-carboxylic acid.
| Compound Name | 10-tert-butyl-1-pyridin-2-yl-2H-phenoselenazin-2-ide;iridium;3,4,5,6-tetramethylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 153432920 |
| Molecular Formula | C31H32IrN3O2Se- |
| Molecular Weight | 749.79 g/mol |
| Exact Mass | 751.13 |
| IUPAC Name | 10-tert-butyl-1-pyridin-2-yl-2H-phenoselenazin-2-ide;iridium;3,4,5,6-tetramethylpyridine-2-carboxylic acid |
| SMILES | CC(C)(C)N1c2ccccc2[Se]c2cc[c-]c(-c3ccccn3)c21.Cc1nc(C(=O)O)c(C)c(C)c1C.[Ir] |
| InChI | InChI=1S/C21H19N2Se.C10H13NO2.Ir/c1-21(2,3)23-17-11-4-5-12-18(17)24-19-13-8-9-15(20(19)23)16-10-6-7-14-22-16;1-5-6(2)8(4)11-9(7(5)3)10(12)13;/h4-8,10-14H,1-3H3;1-4H3,(H,12,13);/q-1;; |
| InChIKey | QRAPPCVRBMUEOH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.79 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|