C14H12F3IrNO2 — CID 58986704
iridium;2-(2-methylbenzene-6-id-1-yl)pyridine;(2,2,2-trifluoro-1-hydroxyethylidene)oxidanium (PubChem CID 58986704) has the molecular formula C14H12F3IrNO2 and a molecular weight of 475.47 g/mol. Its IUPAC name is iridium;2-(2-methylbenzene-6-id-1-yl)pyridine;(2,2,2-trifluoro-1-hydroxyethylidene)oxidanium.
| Compound Name | iridium;2-(2-methylbenzene-6-id-1-yl)pyridine;(2,2,2-trifluoro-1-hydroxyethylidene)oxidanium |
|---|---|
| PubChem CID | 58986704 |
| Molecular Formula | C14H12F3IrNO2 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | iridium;2-(2-methylbenzene-6-id-1-yl)pyridine;(2,2,2-trifluoro-1-hydroxyethylidene)oxidanium |
| SMILES | Cc1ccc[c-]c1-c1ccccn1.[H]/[O+]=C(/O)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C12H10N.C2HF3O2.Ir/c1-10-6-2-3-7-11(10)12-8-4-5-9-13-12;3-2(4,5)1(6)7;/h2-6,8-9H,1H3;(H,6,7);/q-1;;/p+1 |
| InChIKey | YSOYJFZHKDYPQZ-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|