C33H41IrN2O3S- — CID 153433065
6,7-dimethyl-4-thieno[3,2-c]pyridin-4-yl-10-(trideuteriomethyl)-3H-phenoxazin-3-ide;iridium;2,2,6,6-tetramethylheptane-3,5-diol (PubChem CID 153433065) has the molecular formula C33H41IrN2O3S- and a molecular weight of 741.00 g/mol. Its IUPAC name is 6,7-dimethyl-4-thieno[3,2-c]pyridin-4-yl-10-(trideuteriomethyl)-3H-phenoxazin-3-ide;iridium;2,2,6,6-tetramethylheptane-3,5-diol.
| Compound Name | 6,7-dimethyl-4-thieno[3,2-c]pyridin-4-yl-10-(trideuteriomethyl)-3H-phenoxazin-3-ide;iridium;2,2,6,6-tetramethylheptane-3,5-diol |
|---|---|
| PubChem CID | 153433065 |
| Molecular Formula | C33H41IrN2O3S- |
| Molecular Weight | 741.00 g/mol |
| Exact Mass | 741.27 |
| IUPAC Name | 6,7-dimethyl-4-thieno[3,2-c]pyridin-4-yl-10-(trideuteriomethyl)-3H-phenoxazin-3-ide;iridium;2,2,6,6-tetramethylheptane-3,5-diol |
| SMILES | CC(C)(C)C(O)CC(O)C(C)(C)C.[2H]C([2H])([2H])N1c2cc[c-]c(-c3nccc4sccc34)c2Oc2c1ccc(C)c2C.[Ir] |
| InChI | InChI=1S/C22H17N2OS.C11H24O2.Ir/c1-13-7-8-18-21(14(13)2)25-22-16(5-4-6-17(22)24(18)3)20-15-10-12-26-19(15)9-11-23-20;1-10(2,3)8(12)7-9(13)11(4,5)6;/h4,6-12H,1-3H3;8-9,12-13H,7H2,1-6H3;/q-1;;/i3D3;; |
| InChIKey | YLVHJGARSSFYFF-RNHVAZJGSA-N |
| XLogP | 8.44 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.00 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|