C37H26IrN2OS-2 — CID 153433197
3-(9,9-dimethyl-3H-xanthen-3-id-4-yl)-[1]benzothiolo[2,3-c]pyridine;iridium;2-phenylpyridine (PubChem CID 153433197) has the molecular formula C37H26IrN2OS-2 and a molecular weight of 738.91 g/mol. Its IUPAC name is 3-(9,9-dimethyl-3H-xanthen-3-id-4-yl)-[1]benzothiolo[2,3-c]pyridine;iridium;2-phenylpyridine.
| Compound Name | 3-(9,9-dimethyl-3H-xanthen-3-id-4-yl)-[1]benzothiolo[2,3-c]pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 153433197 |
| Molecular Formula | C37H26IrN2OS-2 |
| Molecular Weight | 738.91 g/mol |
| Exact Mass | 739.14 |
| IUPAC Name | 3-(9,9-dimethyl-3H-xanthen-3-id-4-yl)-[1]benzothiolo[2,3-c]pyridine;iridium;2-phenylpyridine |
| SMILES | CC1(C)c2ccccc2Oc2c(-c3cc4c(cn3)sc3ccccc34)[c-]ccc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H18NOS.C11H8N.Ir/c1-26(2)19-10-4-5-12-22(19)28-25-17(9-7-11-20(25)26)21-14-18-16-8-3-6-13-23(16)29-24(18)15-27-21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-8,10-15H,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | WIEMCDDAFMUKOR-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.91 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|