C48H40N4 — CID 153434765
2-[4-[2-[3,5-bis[(Z)-2-(4-pyridin-2-ylphenyl)ethenyl]cyclohexyl]phenyl]phenyl]pyrimidine (PubChem CID 153434765) has the molecular formula C48H40N4 and a molecular weight of 672.88 g/mol. Its IUPAC name is 2-[4-[2-[3,5-bis[(Z)-2-(4-pyridin-2-ylphenyl)ethenyl]cyclohexyl]phenyl]phenyl]pyrimidine.
| Compound Name | 2-[4-[2-[3,5-bis[(Z)-2-(4-pyridin-2-ylphenyl)ethenyl]cyclohexyl]phenyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 153434765 |
| Molecular Formula | C48H40N4 |
| Molecular Weight | 672.88 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | 2-[4-[2-[3,5-bis[(Z)-2-(4-pyridin-2-ylphenyl)ethenyl]cyclohexyl]phenyl]phenyl]pyrimidine |
| SMILES | C(=C\C1CC(/C=C\c2ccc(-c3ccccn3)cc2)CC(c2ccccc2-c2ccc(-c3ncccn3)cc2)C1)\c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C48H40N4/c1-2-9-45(44(8-1)39-24-26-42(27-25-39)48-51-30-7-31-52-48)43-33-37(14-12-35-16-20-40(21-17-35)46-10-3-5-28-49-46)32-38(34-43)15-13-36-18-22-41(23-19-36)47-11-4-6-29-50-47/h1-31,37-38,43H,32-34H2/b14-12-,15-13- |
| InChIKey | UGGMDOTWHHCMRW-DZDAAMPGSA-N |
| XLogP | 11.86 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.88 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |