C10H18F2N3O11P3S — CID 153435857
[[(3S)-5-(4-amino-5-fluoro-2-sulfanylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methylpentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 153435857) has the molecular formula C10H18F2N3O11P3S and a molecular weight of 519.25 g/mol. Its IUPAC name is [[(3S)-5-(4-amino-5-fluoro-2-sulfanylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methylpentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3S)-5-(4-amino-5-fluoro-2-sulfanylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methylpentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 153435857 |
| Molecular Formula | C10H18F2N3O11P3S |
| Molecular Weight | 519.25 g/mol |
| Exact Mass | 518.98 |
| IUPAC Name | [[(3S)-5-(4-amino-5-fluoro-2-sulfanylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methylpentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(F)(Cn1cc(F)c(N)nc1=S)[C@@H](O)CCOP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H18F2N3O11P3S/c1-10(12,5-15-4-6(11)8(13)14-9(15)30)7(16)2-3-24-28(20,21)26-29(22,23)25-27(17,18)19/h4,7,16H,2-3,5H2,1H3,(H,20,21)(H,22,23)(H2,13,14,30)(H2,17,18,19)/t7-,10?/m0/s1 |
| InChIKey | VCJLIMMADJNUBB-BYDSUWOYSA-N |
| XLogP | 1.16 |
| TPSA | 223.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|