C10H19FN3O11P3S — CID 153435789
[[(3S)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methylpentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 153435789) has the molecular formula C10H19FN3O11P3S and a molecular weight of 501.26 g/mol. Its IUPAC name is [[(3S)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methylpentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3S)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methylpentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 153435789 |
| Molecular Formula | C10H19FN3O11P3S |
| Molecular Weight | 501.26 g/mol |
| Exact Mass | 500.99 |
| IUPAC Name | [[(3S)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methylpentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(F)(Cn1ccc(N)nc1=S)[C@@H](O)CCOP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H19FN3O11P3S/c1-10(11,6-14-4-2-8(12)13-9(14)29)7(15)3-5-23-27(19,20)25-28(21,22)24-26(16,17)18/h2,4,7,15H,3,5-6H2,1H3,(H,19,20)(H,21,22)(H2,12,13,29)(H2,16,17,18)/t7-,10?/m0/s1 |
| InChIKey | QRPPQIXDBZQPQZ-BYDSUWOYSA-N |
| XLogP | 1.02 |
| TPSA | 223.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|