C10H16FN2O12P3SU — CID 153435793
[[(3S)-4-fluoro-3-hydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate;uranium(2+) (PubChem CID 153435793) has the molecular formula C10H16FN2O12P3SU and a molecular weight of 738.26 g/mol. Its IUPAC name is [[(3S)-4-fluoro-3-hydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate;uranium(2+).
| Compound Name | [[(3S)-4-fluoro-3-hydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate;uranium(2+) |
|---|---|
| PubChem CID | 153435793 |
| Molecular Formula | C10H16FN2O12P3SU |
| Molecular Weight | 738.26 g/mol |
| Exact Mass | 738.01 |
| IUPAC Name | [[(3S)-4-fluoro-3-hydroxy-4-methyl-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate;uranium(2+) |
| SMILES | CC(F)([CH-]n1ccc(=O)[nH]c1=S)[C@@H](O)[CH-]COP(=O)(O)OP(=O)(O)OP(=O)(O)O.[U+2] |
| InChI | InChI=1S/C10H16FN2O12P3S.U/c1-10(11,6-13-4-2-8(15)12-9(13)29)7(14)3-5-23-27(19,20)25-28(21,22)24-26(16,17)18;/h2-4,6-7,14H,5H2,1H3,(H,19,20)(H,21,22)(H,12,15,29)(H2,16,17,18);/q-2;+2/t7-,10?;/m0./s1 |
| InChIKey | JISCBMVZQRGUNM-WFWYDLLNSA-N |
| XLogP | 0.55 |
| TPSA | 217.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|