C13H22FN2O15P3 — CID 138690193
[[(3S)-2-[(1R)-1-(2,4-dioxopyrimidin-1-yl)-3-methylbut-3-enoxy]-2-fluoro-3,4-dihydroxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 138690193) has the molecular formula C13H22FN2O15P3 and a molecular weight of 558.24 g/mol. Its IUPAC name is [[(3S)-2-[(1R)-1-(2,4-dioxopyrimidin-1-yl)-3-methylbut-3-enoxy]-2-fluoro-3,4-dihydroxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3S)-2-[(1R)-1-(2,4-dioxopyrimidin-1-yl)-3-methylbut-3-enoxy]-2-fluoro-3,4-dihydroxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 138690193 |
| Molecular Formula | C13H22FN2O15P3 |
| Molecular Weight | 558.24 g/mol |
| Exact Mass | 558.02 |
| IUPAC Name | [[(3S)-2-[(1R)-1-(2,4-dioxopyrimidin-1-yl)-3-methylbut-3-enoxy]-2-fluoro-3,4-dihydroxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C(C)C[C@@H](OC(F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)CO)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H22FN2O15P3/c1-8(2)5-11(16-4-3-10(19)15-12(16)20)29-13(14,9(18)6-17)7-28-33(24,25)31-34(26,27)30-32(21,22)23/h3-4,9,11,17-18H,1,5-7H2,2H3,(H,24,25)(H,26,27)(H,15,19,20)(H2,21,22,23)/t9-,11+,13?/m0/s1 |
| InChIKey | RAMZACKREFNBND-QQTYBIEJSA-N |
| XLogP | -0.62 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.24 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|