C11H20ClN2O14P3 — CID 129013888
[[(2R,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-hydroxy-2-methoxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129013888) has the molecular formula C11H20ClN2O14P3 and a molecular weight of 532.66 g/mol. Its IUPAC name is [[(2R,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-hydroxy-2-methoxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-hydroxy-2-methoxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129013888 |
| Molecular Formula | C11H20ClN2O14P3 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 531.98 |
| IUPAC Name | [[(2R,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-hydroxy-2-methoxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC[C@](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)(OC)[C@@H](O)[C@@H](Cl)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H20ClN2O14P3/c1-3-11(25-2,8(16)9(12)14-5-4-7(15)13-10(14)17)6-26-30(21,22)28-31(23,24)27-29(18,19)20/h4-5,8-9,16H,3,6H2,1-2H3,(H,21,22)(H,23,24)(H,13,15,17)(H2,18,19,20)/t8-,9-,11+/m0/s1 |
| InChIKey | CNHMFLIXWWSKOI-ATZCPNFKSA-N |
| XLogP | -0.23 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|