C10H14Cl2FN2O7P — CID 118612367
1-[(1R,2R,3S,4S)-5-dichlorophosphoryloxy-4-fluoro-1,2,3-trihydroxy-2-methylpentyl]pyrimidine-2,4-dione (PubChem CID 118612367) has the molecular formula C10H14Cl2FN2O7P and a molecular weight of 395.11 g/mol. Its IUPAC name is 1-[(1R,2R,3S,4S)-5-dichlorophosphoryloxy-4-fluoro-1,2,3-trihydroxy-2-methylpentyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2R,3S,4S)-5-dichlorophosphoryloxy-4-fluoro-1,2,3-trihydroxy-2-methylpentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118612367 |
| Molecular Formula | C10H14Cl2FN2O7P |
| Molecular Weight | 395.11 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 1-[(1R,2R,3S,4S)-5-dichlorophosphoryloxy-4-fluoro-1,2,3-trihydroxy-2-methylpentyl]pyrimidine-2,4-dione |
| SMILES | C[C@@](O)([C@H](O)[C@@H](F)COP(=O)(Cl)Cl)[C@@H](O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14Cl2FN2O7P/c1-10(20,7(17)5(13)4-22-23(11,12)21)8(18)15-3-2-6(16)14-9(15)19/h2-3,5,7-8,17-18,20H,4H2,1H3,(H,14,16,19)/t5-,7+,8+,10+/m0/s1 |
| InChIKey | FVESCHYVFPMXQZ-LJHRJBCISA-N |
| XLogP | 0.08 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.11 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|