C11H19ClFN2O14P3 — CID 129014047
[[(2R,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-(1-fluoroethyl)-3-hydroxy-2-methoxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129014047) has the molecular formula C11H19ClFN2O14P3 and a molecular weight of 550.65 g/mol. Its IUPAC name is [[(2R,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-(1-fluoroethyl)-3-hydroxy-2-methoxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-(1-fluoroethyl)-3-hydroxy-2-methoxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129014047 |
| Molecular Formula | C11H19ClFN2O14P3 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 549.97 |
| IUPAC Name | [[(2R,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-(1-fluoroethyl)-3-hydroxy-2-methoxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CO[C@@](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)(C(C)F)[C@@H](O)[C@@H](Cl)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H19ClFN2O14P3/c1-6(13)11(26-2,8(17)9(12)15-4-3-7(16)14-10(15)18)5-27-31(22,23)29-32(24,25)28-30(19,20)21/h3-4,6,8-9,17H,5H2,1-2H3,(H,22,23)(H,24,25)(H,14,16,18)(H2,19,20,21)/t6?,8-,9-,11-/m0/s1 |
| InChIKey | AXOBBXXZLUFPCU-IVCAWBQRSA-N |
| XLogP | -0.28 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|