C18H33N2O8P — CID 123330941
[7-(2,4-dioxopyrimidin-1-yl)-3,5-diethyl-6,7-dihydroxyheptan-3-yl]oxy-(2-hydroxypropan-2-yl)phosphinic acid (PubChem CID 123330941) has the molecular formula C18H33N2O8P and a molecular weight of 436.44 g/mol. Its IUPAC name is [7-(2,4-dioxopyrimidin-1-yl)-3,5-diethyl-6,7-dihydroxyheptan-3-yl]oxy-(2-hydroxypropan-2-yl)phosphinic acid.
| Compound Name | [7-(2,4-dioxopyrimidin-1-yl)-3,5-diethyl-6,7-dihydroxyheptan-3-yl]oxy-(2-hydroxypropan-2-yl)phosphinic acid |
|---|---|
| PubChem CID | 123330941 |
| Molecular Formula | C18H33N2O8P |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [7-(2,4-dioxopyrimidin-1-yl)-3,5-diethyl-6,7-dihydroxyheptan-3-yl]oxy-(2-hydroxypropan-2-yl)phosphinic acid |
| SMILES | CCC(CC(CC)(CC)OP(=O)(O)C(C)(C)O)C(O)C(O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H33N2O8P/c1-6-12(14(22)15(23)20-10-9-13(21)19-16(20)24)11-18(7-2,8-3)28-29(26,27)17(4,5)25/h9-10,12,14-15,22-23,25H,6-8,11H2,1-5H3,(H,26,27)(H,19,21,24) |
| InChIKey | WPTQHQWTSWLUJB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|