C8H13FN3O11P3S — CID 153435775
[(2R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-fluorooxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 153435775) has the molecular formula C8H13FN3O11P3S and a molecular weight of 471.19 g/mol. Its IUPAC name is [(2R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-fluorooxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-fluorooxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 153435775 |
| Molecular Formula | C8H13FN3O11P3S |
| Molecular Weight | 471.19 g/mol |
| Exact Mass | 470.95 |
| IUPAC Name | [(2R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-4-fluorooxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2O[C@H](OP(=O)(O)OP(=O)(O)OP(=O)(O)O)CC2F)c(=S)n1 |
| InChI | InChI=1S/C8H13FN3O11P3S/c9-4-3-6(20-7(4)12-2-1-5(10)11-8(12)27)21-25(16,17)23-26(18,19)22-24(13,14)15/h1-2,4,6-7H,3H2,(H,16,17)(H,18,19)(H2,10,11,27)(H2,13,14,15)/t4?,6-,7-/m1/s1 |
| InChIKey | KTXKKBRDBXVCII-AMUJUKTHSA-N |
| XLogP | 1.12 |
| TPSA | 212.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|