C14H22N2O4S — CID 153438038
tert-butyl 5-methoxy-2-(1-oxothian-4-yl)imidazole-1-carboxylate (PubChem CID 153438038) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is tert-butyl 5-methoxy-2-(1-oxothian-4-yl)imidazole-1-carboxylate.
| Compound Name | tert-butyl 5-methoxy-2-(1-oxothian-4-yl)imidazole-1-carboxylate |
|---|---|
| PubChem CID | 153438038 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | tert-butyl 5-methoxy-2-(1-oxothian-4-yl)imidazole-1-carboxylate |
| SMILES | COc1cnc(C2CCS(=O)CC2)n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O4S/c1-14(2,3)20-13(17)16-11(19-4)9-15-12(16)10-5-7-21(18)8-6-10/h9-10H,5-8H2,1-4H3 |
| InChIKey | PCGBAHSLAOCVOU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |