C12H16N2O3 — CID 139558422
tert-butyl 2-cyclopropyl-5-formylimidazole-1-carboxylate (PubChem CID 139558422) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is tert-butyl 2-cyclopropyl-5-formylimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-cyclopropyl-5-formylimidazole-1-carboxylate |
|---|---|
| PubChem CID | 139558422 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | tert-butyl 2-cyclopropyl-5-formylimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(C=O)cnc1C1CC1 |
| InChI | InChI=1S/C12H16N2O3/c1-12(2,3)17-11(16)14-9(7-15)6-13-10(14)8-4-5-8/h6-8H,4-5H2,1-3H3 |
| InChIKey | NGQIVGQLKMAVFB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|