C19H28O2 — CID 15344135
ethyl (E)-3-(4,4-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-6-yl)but-2-enoate (PubChem CID 15344135) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is ethyl (E)-3-(4,4-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-6-yl)but-2-enoate.
| Compound Name | ethyl (E)-3-(4,4-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-6-yl)but-2-enoate |
|---|---|
| PubChem CID | 15344135 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | ethyl (E)-3-(4,4-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-6-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)C1=CC2=C(CCC1)CCCC2(C)C |
| InChI | InChI=1S/C19H28O2/c1-5-21-18(20)12-14(2)16-9-6-8-15-10-7-11-19(3,4)17(15)13-16/h12-13H,5-11H2,1-4H3/b14-12+ |
| InChIKey | WRKZKTCLGCQAJJ-WYMLVPIESA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|