C10H18F3O4P — CID 153445197
[6,6-dimethyl-5-oxo-4-(trifluoromethyl)heptyl]phosphonic acid (PubChem CID 153445197) has the molecular formula C10H18F3O4P and a molecular weight of 290.22 g/mol. Its IUPAC name is [6,6-dimethyl-5-oxo-4-(trifluoromethyl)heptyl]phosphonic acid.
| Compound Name | [6,6-dimethyl-5-oxo-4-(trifluoromethyl)heptyl]phosphonic acid |
|---|---|
| PubChem CID | 153445197 |
| Molecular Formula | C10H18F3O4P |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [6,6-dimethyl-5-oxo-4-(trifluoromethyl)heptyl]phosphonic acid |
| SMILES | CC(C)(C)C(=O)C(CCCP(=O)(O)O)C(F)(F)F |
| InChI | InChI=1S/C10H18F3O4P/c1-9(2,3)8(14)7(10(11,12)13)5-4-6-18(15,16)17/h7H,4-6H2,1-3H3,(H2,15,16,17) |
| InChIKey | MPPSVAHHMKGYAO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|