C17H37O3P — CID 176908190
[6-ethyl-7,7-dimethyl-4-(2-methylbutan-2-yl)octyl]phosphonic acid (PubChem CID 176908190) has the molecular formula C17H37O3P and a molecular weight of 320.45 g/mol. Its IUPAC name is [6-ethyl-7,7-dimethyl-4-(2-methylbutan-2-yl)octyl]phosphonic acid.
| Compound Name | [6-ethyl-7,7-dimethyl-4-(2-methylbutan-2-yl)octyl]phosphonic acid |
|---|---|
| PubChem CID | 176908190 |
| Molecular Formula | C17H37O3P |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | [6-ethyl-7,7-dimethyl-4-(2-methylbutan-2-yl)octyl]phosphonic acid |
| SMILES | CCC(CC(CCCP(=O)(O)O)C(C)(C)CC)C(C)(C)C |
| InChI | InChI=1S/C17H37O3P/c1-8-14(16(3,4)5)13-15(17(6,7)9-2)11-10-12-21(18,19)20/h14-15H,8-13H2,1-7H3,(H2,18,19,20) |
| InChIKey | LRFWPJQWYYHUID-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|