C19H32O5 — CID 15344583
ethyl (4E,8E)-9-(1,3-dioxolan-2-yl)-3-hydroxy-5-methyl-2-propan-2-yldeca-4,8-dienoate (PubChem CID 15344583) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is ethyl (4E,8E)-9-(1,3-dioxolan-2-yl)-3-hydroxy-5-methyl-2-propan-2-yldeca-4,8-dienoate.
| Compound Name | ethyl (4E,8E)-9-(1,3-dioxolan-2-yl)-3-hydroxy-5-methyl-2-propan-2-yldeca-4,8-dienoate |
|---|---|
| PubChem CID | 15344583 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethyl (4E,8E)-9-(1,3-dioxolan-2-yl)-3-hydroxy-5-methyl-2-propan-2-yldeca-4,8-dienoate |
| SMILES | CCOC(=O)C(C(C)C)C(O)/C=C(\C)CC/C=C(\C)C1OCCO1 |
| InChI | InChI=1S/C19H32O5/c1-6-22-18(21)17(13(2)3)16(20)12-14(4)8-7-9-15(5)19-23-10-11-24-19/h9,12-13,16-17,19-20H,6-8,10-11H2,1-5H3/b14-12+,15-9+ |
| InChIKey | QXTNFTSCBXFAIZ-NSDDURSASA-N |
| XLogP | 3.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|