C22H38O5 — CID 10500125
ethyl 2-[2-[(1E,5E)-9-(hydroxymethyl)-2,6,10-trimethylundeca-1,5-dienyl]-1,3-dioxolan-2-yl]acetate (PubChem CID 10500125) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is ethyl 2-[2-[(1E,5E)-9-(hydroxymethyl)-2,6,10-trimethylundeca-1,5-dienyl]-1,3-dioxolan-2-yl]acetate.
| Compound Name | ethyl 2-[2-[(1E,5E)-9-(hydroxymethyl)-2,6,10-trimethylundeca-1,5-dienyl]-1,3-dioxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10500125 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | ethyl 2-[2-[(1E,5E)-9-(hydroxymethyl)-2,6,10-trimethylundeca-1,5-dienyl]-1,3-dioxolan-2-yl]acetate |
| SMILES | CCOC(=O)CC1(/C=C(\C)CC/C=C(\C)CCC(CO)C(C)C)OCCO1 |
| InChI | InChI=1S/C22H38O5/c1-6-25-21(24)15-22(26-12-13-27-22)14-19(5)9-7-8-18(4)10-11-20(16-23)17(2)3/h8,14,17,20,23H,6-7,9-13,15-16H2,1-5H3/b18-8+,19-14+ |
| InChIKey | PIBGBMSGFUORSU-SFEMZCJXSA-N |
| XLogP | 4.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|