C28H48O7 — CID 102220972
(1R,4S,5S,9R,10E,12R)-4-[(E,4R,5S,6S,7R)-5,9-dihydroxy-7-methoxy-4,6-dimethylnon-2-en-2-yl]-5,9,14,14-tetramethyl-3,13,15-trioxabicyclo[10.3.0]pentadec-10-en-2-one (PubChem CID 102220972) has the molecular formula C28H48O7 and a molecular weight of 496.69 g/mol. Its IUPAC name is (1R,4S,5S,9R,10E,12R)-4-[(E,4R,5S,6S,7R)-5,9-dihydroxy-7-methoxy-4,6-dimethylnon-2-en-2-yl]-5,9,14,14-tetramethyl-3,13,15-trioxabicyclo[10.3.0]pentadec-10-en-2-one.
| Compound Name | (1R,4S,5S,9R,10E,12R)-4-[(E,4R,5S,6S,7R)-5,9-dihydroxy-7-methoxy-4,6-dimethylnon-2-en-2-yl]-5,9,14,14-tetramethyl-3,13,15-trioxabicyclo[10.3.0]pentadec-10-en-2-one |
|---|---|
| PubChem CID | 102220972 |
| Molecular Formula | C28H48O7 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (1R,4S,5S,9R,10E,12R)-4-[(E,4R,5S,6S,7R)-5,9-dihydroxy-7-methoxy-4,6-dimethylnon-2-en-2-yl]-5,9,14,14-tetramethyl-3,13,15-trioxabicyclo[10.3.0]pentadec-10-en-2-one |
| SMILES | CO[C@H](CCO)[C@@H](C)[C@@H](O)[C@H](C)/C=C(\C)[C@H]1OC(=O)[C@@H]2OC(C)(C)O[C@@H]2/C=C/[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C28H48O7/c1-17-10-9-11-18(2)25(33-27(31)26-23(13-12-17)34-28(6,7)35-26)20(4)16-19(3)24(30)21(5)22(32-8)14-15-29/h12-13,16-19,21-26,29-30H,9-11,14-15H2,1-8H3/b13-12+,20-16+/t17-,18+,19-,21-,22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | UUGKHNODUQNIJQ-COWVMNJUSA-N |
| XLogP | 4.41 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|