C16H26O5 — CID 10780422
ethyl (4E,8E)-9-(1,3-dioxolan-2-yl)-3-hydroxy-5-methyldeca-4,8-dienoate (PubChem CID 10780422) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl (4E,8E)-9-(1,3-dioxolan-2-yl)-3-hydroxy-5-methyldeca-4,8-dienoate.
| Compound Name | ethyl (4E,8E)-9-(1,3-dioxolan-2-yl)-3-hydroxy-5-methyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 10780422 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | ethyl (4E,8E)-9-(1,3-dioxolan-2-yl)-3-hydroxy-5-methyldeca-4,8-dienoate |
| SMILES | CCOC(=O)CC(O)/C=C(\C)CC/C=C(\C)C1OCCO1 |
| InChI | InChI=1S/C16H26O5/c1-4-19-15(18)11-14(17)10-12(2)6-5-7-13(3)16-20-8-9-21-16/h7,10,14,16-17H,4-6,8-9,11H2,1-3H3/b12-10+,13-7+ |
| InChIKey | XHZKBVGEWFTEOG-PVYBRLDNSA-N |
| XLogP | 2.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|