C49H44ClN4O+ — CID 153448492
4-[(1R)-1-(6-chloro-2,5-diphenylpyrimidin-4-yl)oxy-2-[5-ethenyl-1-[(3-phenylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]ethyl]quinoline (PubChem CID 153448492) has the molecular formula C49H44ClN4O+ and a molecular weight of 740.37 g/mol. Its IUPAC name is 4-[(1R)-1-(6-chloro-2,5-diphenylpyrimidin-4-yl)oxy-2-[5-ethenyl-1-[(3-phenylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]ethyl]quinoline.
| Compound Name | 4-[(1R)-1-(6-chloro-2,5-diphenylpyrimidin-4-yl)oxy-2-[5-ethenyl-1-[(3-phenylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]ethyl]quinoline |
|---|---|
| PubChem CID | 153448492 |
| Molecular Formula | C49H44ClN4O+ |
| Molecular Weight | 740.37 g/mol |
| Exact Mass | 739.32 |
| IUPAC Name | 4-[(1R)-1-(6-chloro-2,5-diphenylpyrimidin-4-yl)oxy-2-[5-ethenyl-1-[(3-phenylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]ethyl]quinoline |
| SMILES | C=CC1C[N+]2(Cc3cccc(-c4ccccc4)c3)CCC1CC2C[C@@H](Oc1nc(-c2ccccc2)nc(Cl)c1-c1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C49H44ClN4O/c1-2-35-33-54(32-34-15-14-22-39(29-34)36-16-6-3-7-17-36)28-26-40(35)30-41(54)31-45(43-25-27-51-44-24-13-12-23-42(43)44)55-49-46(37-18-8-4-9-19-37)47(50)52-48(53-49)38-20-10-5-11-21-38/h2-25,27,29,35,40-41,45H,1,26,28,30-33H2/q+1/t35?,40?,41?,45-,54?/m1/s1 |
| InChIKey | CBZHHHYDPDCFAI-HDEWFGTHSA-N |
| XLogP | 11.80 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.37 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|