C48H42ClN4O+ — CID 129255105
4-[(S)-(6-chloro-2,5-diphenylpyrimidin-4-yl)oxy-[5-ethenyl-1-[(3-phenylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinoline (PubChem CID 129255105) has the molecular formula C48H42ClN4O+ and a molecular weight of 726.34 g/mol. Its IUPAC name is 4-[(S)-(6-chloro-2,5-diphenylpyrimidin-4-yl)oxy-[5-ethenyl-1-[(3-phenylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinoline.
| Compound Name | 4-[(S)-(6-chloro-2,5-diphenylpyrimidin-4-yl)oxy-[5-ethenyl-1-[(3-phenylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinoline |
|---|---|
| PubChem CID | 129255105 |
| Molecular Formula | C48H42ClN4O+ |
| Molecular Weight | 726.34 g/mol |
| Exact Mass | 725.30 |
| IUPAC Name | 4-[(S)-(6-chloro-2,5-diphenylpyrimidin-4-yl)oxy-[5-ethenyl-1-[(3-phenylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinoline |
| SMILES | C=CC1C[N+]2(Cc3cccc(-c4ccccc4)c3)CCC1CC2[C@@H](Oc1nc(-c2ccccc2)nc(Cl)c1-c1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C48H42ClN4O/c1-2-34-32-53(31-33-15-14-22-38(29-33)35-16-6-3-7-17-35)28-26-39(34)30-43(53)45(41-25-27-50-42-24-13-12-23-40(41)42)54-48-44(36-18-8-4-9-19-36)46(49)51-47(52-48)37-20-10-5-11-21-37/h2-25,27,29,34,39,43,45H,1,26,28,30-32H2/q+1/t34?,39?,43?,45-,53?/m0/s1 |
| InChIKey | RWCLCTXVUMFMOJ-RWVTVGAHSA-N |
| XLogP | 11.41 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.34 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|