C17H18NO2Y- — CID 153450898
6-(4-but-2-ynoxyphenyl)-1,3-dimethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153450898) has the molecular formula C17H18NO2Y- and a molecular weight of 357.24 g/mol. Its IUPAC name is 6-(4-but-2-ynoxyphenyl)-1,3-dimethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-(4-but-2-ynoxyphenyl)-1,3-dimethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153450898 |
| Molecular Formula | C17H18NO2Y- |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 6-(4-but-2-ynoxyphenyl)-1,3-dimethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CC#CCOc1ccc(C2=[C-]CC(C)C(=O)N2C)cc1.[Y] |
| InChI | InChI=1S/C17H18NO2.Y/c1-4-5-12-20-15-9-7-14(8-10-15)16-11-6-13(2)17(19)18(16)3;/h7-10,13H,6,12H2,1-3H3;/q-1; |
| InChIKey | WAIQWQSUZODNSA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|