C17H18BrNO2 — CID 153451812
3-bromo-6-(4-but-2-ynoxyphenyl)-1-ethyl-3,4-dihydropyridin-2-one (PubChem CID 153451812) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 3-bromo-6-(4-but-2-ynoxyphenyl)-1-ethyl-3,4-dihydropyridin-2-one.
| Compound Name | 3-bromo-6-(4-but-2-ynoxyphenyl)-1-ethyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451812 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 3-bromo-6-(4-but-2-ynoxyphenyl)-1-ethyl-3,4-dihydropyridin-2-one |
| SMILES | CC#CCOc1ccc(C2=CCC(Br)C(=O)N2CC)cc1 |
| InChI | InChI=1S/C17H18BrNO2/c1-3-5-12-21-14-8-6-13(7-9-14)16-11-10-15(18)17(20)19(16)4-2/h6-9,11,15H,4,10,12H2,1-2H3 |
| InChIKey | NHQPZDPHFKANFH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|