C19H15N4OPt-3 — CID 153453722
3-phenyl-5-[2-(3-phenyl-2H-imidazol-2-id-1-yl)ethyl]-1,2,4-oxadiazole;platinum (PubChem CID 153453722) has the molecular formula C19H15N4OPt-3 and a molecular weight of 510.43 g/mol. Its IUPAC name is 3-phenyl-5-[2-(3-phenyl-2H-imidazol-2-id-1-yl)ethyl]-1,2,4-oxadiazole;platinum.
| Compound Name | 3-phenyl-5-[2-(3-phenyl-2H-imidazol-2-id-1-yl)ethyl]-1,2,4-oxadiazole;platinum |
|---|---|
| PubChem CID | 153453722 |
| Molecular Formula | C19H15N4OPt-3 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 3-phenyl-5-[2-(3-phenyl-2H-imidazol-2-id-1-yl)ethyl]-1,2,4-oxadiazole;platinum |
| SMILES | [Pt].[c-]1ccccc1-c1noc(CCN2C=CN(c3[c-]cccc3)[CH-]2)n1 |
| InChI | InChI=1S/C19H15N4O.Pt/c1-3-7-16(8-4-1)19-20-18(24-21-19)11-12-22-13-14-23(15-22)17-9-5-2-6-10-17;/h1-7,9,13-15H,11-12H2;/q-3; |
| InChIKey | DKYJVOWXJRXBJW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|