C28H26IrN3O — CID 153493038
1-cyclohexyl-3-phenyl-2H-imidazol-2-ide;iridium(3+);3-phenyl-1,2-benzoxazole (PubChem CID 153493038) has the molecular formula C28H26IrN3O and a molecular weight of 612.75 g/mol. Its IUPAC name is 1-cyclohexyl-3-phenyl-2H-imidazol-2-ide;iridium(3+);3-phenyl-1,2-benzoxazole.
| Compound Name | 1-cyclohexyl-3-phenyl-2H-imidazol-2-ide;iridium(3+);3-phenyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 153493038 |
| Molecular Formula | C28H26IrN3O |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 1-cyclohexyl-3-phenyl-2H-imidazol-2-ide;iridium(3+);3-phenyl-1,2-benzoxazole |
| SMILES | [Ir+3].[c-]1ccccc1-c1noc2ccccc12.[c-]1ccccc1N1C=CN(C2CCCCC2)[CH-]1 |
| InChI | InChI=1S/C15H18N2.C13H8NO.Ir/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15;1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)15-14-13;/h1,3-4,7,11-13,15H,2,5-6,9-10H2;1-6,8-9H;/q-2;-1;+3 |
| InChIKey | JDVZBFZHYLQYQT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|